CAS 129500-80-7

3-AMINO-5-ETHYLTHIO-1,2,4-THIADIAZOLE

Description:

3-Amino-5-ethylthio-1,2,4-thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom in a five-membered ring structure. The compound features an amino group (-NH2) and an ethylthio group (-S-ethyl) that contribute to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The thiadiazole moiety is known for its diverse applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The compound may exhibit various biological activities, including antimicrobial and antifungal properties, making it of interest in medicinal chemistry. Its specific reactivity and interactions can be influenced by the substituents on the thiadiazole ring, which can affect its electronic properties and steric hindrance. Overall, 3-amino-5-ethylthio-1,2,4-thiadiazole represents a valuable compound in the field of organic and medicinal chemistry.

Formula: C₄H₇N₃S₂

InChI: InChI=1/C4H7N3S2/c1-2-8-4-6-3(5)7-9-4/h2H2,1H3,(H2,5,7)

SMILES: CCSc1nc(=N)[nH]s1

Synonyms:

• 1,2,4-Thiadiazol-3-amine, 5-(ethylthio)-
• 5-(Ethylsulfanyl)-1,2,4-thiadiazol-3-amine