CAS 129520-55-4
:2-hydroxynonafluoroazobenzene
Description:
2-Hydroxynonafluoroazobenzene, with the CAS number 129520-55-4, is a chemical compound characterized by its unique structure that includes an azo group (-N=N-) and a hydroxyl group (-OH) attached to a nonafluorinated aromatic system. This compound exhibits properties typical of azo compounds, such as potential for color and reactivity due to the presence of the azo linkage. The nonafluorinated nature of the compound imparts significant hydrophobic characteristics, making it less soluble in water but potentially soluble in organic solvents. The hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the presence of fluorine atoms contributes to the compound's thermal stability and resistance to chemical degradation. 2-Hydroxynonafluoroazobenzene may find applications in various fields, including materials science and dye chemistry, due to its distinctive properties and potential for functionalization. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C12HF9N2O
InChI:InChI=1/C12HF9N2O/c13-1-2(14)6(18)10(7(19)3(1)15)22-23-11-8(20)4(16)5(17)9(21)12(11)24/h22H
SMILES:c1(c(c(c(c(c1F)F)NN=C1C(=C(C(=C(C1=O)F)F)F)F)F)F)F
Synonyms:- 2,3,4,5-Tetrafluoro-6-((pentafluorophenyl)azo)phenol
- 2-Hnfab
- Phenol, 2,3,4,5-tetrafluoro-6-((pentafluorophenyl)azo)-
- 2,3,4,5-Tetrafluoro-6-[(Pentafluorophenyl)Hydrazono]Cyclohexa-2,4-Dien-1-One
- 2-Hydroxynonafluoroazobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.