CAS 129531-96-0
:2'-deoxy-2'-methylidene-5-fluorocytidine
Description:
2'-Deoxy-2'-methylidene-5-fluorocytidine, with the CAS number 129531-96-0, is a synthetic nucleoside analog that exhibits notable characteristics relevant to its biochemical applications. This compound features a modified sugar moiety, specifically a methylidene group at the 2' position, which enhances its stability and resistance to nucleolytic degradation. The presence of a fluorine atom at the 5-position of the pyrimidine ring contributes to its potential as an antiviral and anticancer agent by interfering with nucleic acid synthesis. Its structural modifications allow it to mimic natural nucleosides, facilitating incorporation into RNA or DNA during replication processes. The compound's unique properties make it a subject of interest in medicinal chemistry, particularly in the development of therapeutics targeting viral infections and certain types of cancer. Additionally, its solubility and reactivity profiles are essential for its efficacy in biological systems, making it a valuable tool in research and pharmaceutical applications.
Formula:C10H12FN3O4
InChI:InChI=1/C10H12FN3O4/c1-4-7(16)6(3-15)18-9(4)14-2-5(11)8(12)13-10(14)17/h2,6-7,9,15-16H,1,3H2,(H2,12,13,17)/t6-,7+,9-/m1/s1
Synonyms:- 2-Dmfc
- Cytidine, 2'-deoxy-5-fluoro-2'-methylene-
- 2'-Deoxy-5-Fluoro-2'-Methylidenecytidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
