CAS 129541-41-9: Sodium 5-bromo-4-chloro-1H-indol-3-yl β-D-glucopyranosiduronate (1:1)
Description:Sodium 5-bromo-4-chloro-1H-indol-3-yl β-D-glucopyranosiduronate (1:1), with the CAS number 129541-41-9, is a chemical compound that features a complex structure combining an indole derivative with a glucopyranosiduronate moiety. This compound is characterized by the presence of halogen substituents (bromine and chlorine) on the indole ring, which can influence its reactivity and biological activity. The glucopyranosiduronate part contributes to its solubility and potential interactions in biological systems. As a sodium salt, it is likely to be soluble in water, making it suitable for various applications in biochemical research and pharmaceutical development. The compound may exhibit interesting pharmacological properties due to its structural components, which could include antimicrobial or anticancer activities, although specific biological effects would require further investigation. Overall, its unique combination of functional groups and structural features makes it a compound of interest in medicinal chemistry and related fields.
Formula:C14H13BrClNO7·Na
InChI:InChI=1S/C14H13BrClNO7.Na/c15-4-1-2-5-7(8(4)16)6(3-17-5)23-14-11(20)9(18)10(19)12(24-14)13(21)22;/h1-3,9-12,14,17-20H,(H,21,22);/t9-,10-,11+,12-,14+;/m0./s1
InChI key:InChIKey=LGUWKXOPXWJLQX-CYRSAHDMSA-N
SMILES:[Na].O=C(O)C1OC(OC2=CNC=3C=CC(Br)=C(Cl)C23)C(O)C(O)C1O
- Synonyms:
- Sodium 5-bromo-4-chloro-1H-indol-3-yl β-D-glucopyranosiduronate (1:1)
- β-D-Glucopyranosiduronic acid, 5-bromo-4-chloro-1H-indol-3-yl, sodium salt (1:1)
- β-D-Glucopyranosiduronic acid, 5-bromo-4-chloro-1H-indol-3-yl, monosodium salt
![5-Bromo-4-chloro-3-indolyl β-D-Glucuronide Sodium Salt [for Biochemical Research]](https://static.cymitquimica.com/products/3B/thumb/B3621.jpg)
