CAS 129541-43-1
:5-bromo-4-chloro-3-indolyl butyrate
Description:
5-Bromo-4-chloro-3-indolyl butyrate is a synthetic chemical compound primarily used as a substrate in biochemical assays, particularly for the detection of certain enzymes like esterases. This compound features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring, and it is substituted with bromine and chlorine atoms, contributing to its reactivity and specificity. The butyrate moiety enhances its solubility and bioavailability, making it suitable for various applications in molecular biology and biochemistry. The presence of halogen substituents can influence the compound's electronic properties, potentially affecting its interaction with biological targets. As a substrate, it is often employed in colorimetric assays, where enzymatic activity can be monitored through the release of a colored product. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper laboratory practices.
Formula:C12H11BrClNO2
InChI:InChI=1/C12H11BrClNO2/c1-2-3-10(16)17-9-6-15-8-5-4-7(13)12(14)11(8)9/h4-6,15H,2-3H2,1H3
SMILES:CCCC(=O)Oc1c[nH]c2ccc(c(c12)Cl)Br
Synonyms:- 5-Bromo-4-chloro-3-indoxyl butyrate
- X-Butyrate
- 5-bromo-4-chloro-1H-indol-3-yl butanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Butanoic acid, 5-bromo-4-chloro-1H-indol-3-yl ester
CAS:Formula:C12H11BrClNO2Purity:98%Color and Shape:SolidMolecular weight:316.57825-Bromo-4-chloro-(1H-indol-3-yl) butanoate
CAS:5-Bromo-4-chloro-(1H-indol-3-yl) butanoateColor and Shape:SolidMolecular weight:316.58g/mol5-Bromo-4-chloro-3-indoxyl butyrate
CAS:5-Bromo-4-chloro-3-indoxyl butyrate is a colorimetric substrate used to detect and quantify esterase activity. Upon hydrolysis by esterases, it yields a blue-green dye, allowing the detection and quantification of enzyme activity. It is commonly used in assays for the screening of esterase-producing microorganisms and in research aimed at understanding the role of esterases in various cellular processes.
Formula:C12H11BrClNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:316.58 g/mol5-Bromo-4-chloro-3-indoxyl butyrate
CAS:Chromogenic substrate for carboxylesterase yielding a blue precipitate upon cleavage. It has been proposed for the rapid detection of Branhamella catarrhalis in a strip test because unlike most other members of the family Neisseriaceae, Branhamella catarrhalis produces a butyrateesterase.Formula:C12H11BrClNO2Purity:Min. 98.0 Area-%Molecular weight:316.59 g/mol



