CAS 1295542-31-2

1-[(3-Chlorophenyl)methyl]-1H-imidazole-4-carboxylic acid

Description:

1-[(3-Chlorophenyl)methyl]-1H-imidazole-4-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 3-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the meta position, contributing to the compound's unique reactivity and potential biological activity. The carboxylic acid functional group (-COOH) at the 4-position of the imidazole ring enhances its acidity and solubility in polar solvents, making it suitable for various applications in pharmaceuticals and biochemistry. This compound may exhibit properties such as antimicrobial or antifungal activity, which is common among imidazole derivatives. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the chlorine substituent can influence the compound's lipophilicity and overall pharmacokinetic profile. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₉ClN₂O₂

InChI: InChI=1S/C11H9ClN2O2/c12-9-3-1-2-8(4-9)5-14-6-10(11(15)16)13-7-14/h1-4,6-7H,5H2,(H,15,16)

InChI key: InChIKey=DDJFYFYMPDTGII-UHFFFAOYSA-N

SMILES: C(N1C=C(C(O)=O)N=C1)C2=CC(Cl)=CC=C2

Synonyms:

• 1-(3-Chlorobenzyl)-1H-imidazole-4-carboxylic acid
• 1-[(3-Chlorophenyl)methyl]-1H-imidazole-4-carboxylic acid
• 1H-Imidazole-4-carboxylic acid, 1-[(3-chlorophenyl)methyl]-

1-(3-Chlorobenzyl)-1H-imidazole-4-carboxylic acid

CAS: 1295542-31-2

Formula: C₁₁H₉ClN₂O₂

Molecular weight: 236.66

Ref: 10-F096847