CAS 129593-17-5
:Boc-D-Cha-ol
Description:
Boc-D-Cha-ol, with the CAS number 129593-17-5, is a chemical compound characterized by its structure as a derivative of D-chiral amino alcohols. The "Boc" (tert-butyloxycarbonyl) group indicates that it is a protected form of the amino group, commonly used in peptide synthesis to prevent unwanted reactions during chemical transformations. This compound typically exhibits properties associated with amino alcohols, such as the ability to participate in hydrogen bonding due to the presence of hydroxyl (-OH) and amino (-NH) functional groups. It is often utilized in organic synthesis, particularly in the preparation of pharmaceuticals and biologically active compounds. The presence of the chiral center allows for the potential to create enantiomerically pure substances, which is crucial in medicinal chemistry. Additionally, Boc-D-Cha-ol may exhibit moderate solubility in polar solvents, making it suitable for various chemical reactions and applications in laboratory settings. As with many organic compounds, proper handling and storage conditions are essential to maintain its stability and reactivity.
Formula:C14H27NO3
InChI:InChI=1S/C14H27NO3/c1-14(2,3)18-13(17)15-12(10-16)9-11-7-5-4-6-8-11/h11-12,16H,4-10H2,1-3H3,(H,15,17)/t12-/m1/s1
InChI key:BOJQBBXPSVGTQT-GFCCVEGCSA-N
SMILES:CC(C)(C)OC(=O)N[C@H](CC1CCCCC1)CO
Synonyms:- Boc-D-Cyclohexylalaninol
- Nalpha-Tert-Butoxycarbonyl-3-Cyclohexyl-D-Alaninol
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
D-Boc-cyclohexylalaninol
CAS:Controlled ProductFormula:C14H27NO3Color and Shape:NeatMolecular weight:257.37
