CAS 129593-20-0
:Benzenebutanoic acid, β-amino-α-hydroxy-, hydrochloride (1:1), (αS,βS)-
Description:
Benzenebutanoic acid, β-amino-α-hydroxy-, hydrochloride (1:1), (αS,βS)-, is a chemical compound characterized by its structural features that include a benzenebutanoic acid backbone with an amino group and a hydroxy group positioned at specific locations on the carbon chain. This compound is a hydrochloride salt, indicating that it is the hydrochloric acid salt form of the base compound, which enhances its solubility in water and may influence its pharmacological properties. The (αS,βS)- designation refers to the specific stereochemistry of the molecule, indicating that it has two chiral centers with defined configurations. This stereochemistry can significantly affect the biological activity and interactions of the compound. Typically, compounds of this nature may exhibit various biological activities, potentially including anti-inflammatory or analgesic effects, making them of interest in pharmaceutical research. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility can vary based on the specific conditions and the presence of other substances.
Formula:C10H13NO3·ClH
InChI:InChI=1S/C10H13NO3.ClH/c11-8(9(12)10(13)14)6-7-4-2-1-3-5-7;/h1-5,8-9,12H,6,11H2,(H,13,14);1H/t8-,9-;/m0./s1
InChI key:InChIKey=OPVMPYQFOLATCK-OZZZDHQUSA-N
SMILES:C([C@@H]([C@@H](C(O)=O)O)N)C1=CC=CC=C1.Cl
Synonyms:- Benzenebutanoic acid, β-amino-α-hydroxy-, hydrochloride, (αS,βS)-
- Benzenebutanoic acid, β-amino-α-hydroxy-, hydrochloride (1:1), (αS,βS)-
- (2S,3S)-3-Amino-2-hydroxy-4-phenylbutyric acid hydrochloride
- Benzenebutanoic acid, β-amino-α-hydroxy-, hydrochloride, [S-(R*,R*)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
