CAS 129604-54-2

1-(9H-FLUOREN-9-YL)PIPERAZINE

Description:

1-(9H-Fluoren-9-yl)piperazine, with the CAS number 129604-54-2, is a chemical compound characterized by its unique structure that combines a piperazine ring with a fluorenyl group. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the fluorenyl moiety contributes to its aromatic properties, which can influence its interactions with biological targets. Additionally, the piperazine ring is known for its versatility in forming various derivatives, making it a valuable scaffold in drug design. The compound may exhibit interesting pharmacological activities, including effects on neurotransmitter systems, which could be relevant for treating psychiatric disorders. Its solubility and stability in different solvents can vary, impacting its bioavailability and efficacy. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 1-(9H-Fluoren-9-yl)piperazine represents a significant compound in the realm of organic and medicinal chemistry.

Formula: C₁₇H₁₈N₂

InChI: InChI=1/C17H18N2/c1-3-7-15-13(5-1)14-6-2-4-8-16(14)17(15)19-11-9-18-10-12-19/h1-8,17-18H,9-12H2

SMILES: c1ccc2c(c1)c1ccccc1C2N1CCNCC1

Synonyms:

• Akos Bbs-00003696

1-(9H-fluoren-9-yl)piperazine hydrochloride

CAS: 129604-54-2

Formula: C₁₇H₁₈N₂

Molecular weight: 250.3382

Ref: IN-DA009GQJ

1-(9H-fluoren-9-yl)piperazine hydrochloride

CAS: 129604-54-2

Formula: C₁₇H₁₈N₂

Molecular weight: 250.345

Ref: 10-F374590

1-(9H-Fluoren-9-yl)piperazine

CAS: 129604-54-2

Versatile small molecule scaffold

Formula: C₁₇H₁₈N₂

Purity: Min. 95%

Molecular weight: 250.34 g/mol

Ref: 3D-EFA60454