
CAS 1296114-58-3
:1,3-Dimethyl 5,5-difluoro-1-(2-propen-1-yl)-1,3-cyclohexanedicarboxylate
Description:
1,3-Dimethyl 5,5-difluoro-1-(2-propen-1-yl)-1,3-cyclohexanedicarboxylate is a chemical compound characterized by its complex structure, which includes a cyclohexane ring with two carboxylate ester groups and multiple substituents. The presence of two methyl groups and two fluorine atoms contributes to its unique reactivity and physical properties. This compound is likely to exhibit moderate polarity due to the ester functional groups, influencing its solubility in various organic solvents. The difluoro substituents may enhance its stability and alter its electronic properties, potentially making it useful in synthetic applications or as an intermediate in organic synthesis. Additionally, the propenyl group suggests potential for further reactions, such as polymerization or cross-coupling. As with many fluorinated compounds, it may exhibit distinct biological activity or environmental behavior, warranting careful handling and assessment of its safety profile. Overall, this compound represents a specialized class of organic molecules with potential applications in pharmaceuticals or materials science.
Formula:C13H18F2O4
InChI:InChI=1S/C13H18F2O4/c1-4-5-12(11(17)19-3)6-9(10(16)18-2)7-13(14,15)8-12/h4,9H,1,5-8H2,2-3H3
InChI key:InChIKey=DOBNRGPEAWRONZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1(CC=C)CC(C(OC)=O)CC(F)(F)C1
Synonyms:- 1,3-Cyclohexanedicarboxylic acid, 5,5-difluoro-1-(2-propen-1-yl)-, 1,3-dimethyl ester
- 1,3-Dimethyl 5,5-difluoro-1-(2-propen-1-yl)-1,3-cyclohexanedicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dimethyl 1-allyl-5,5-difluorocyclohexane-1,3-dicarboxylate
CAS:Formula:C13H18F2O4Molecular weight:276.2764
