CymitQuimica logo

CAS 1296172-36-5

:

Ethyl 3,5-dichloro-4-cyano-2-pyridinecarboxylate

Description:
Ethyl 3,5-dichloro-4-cyano-2-pyridinecarboxylate is a chemical compound characterized by its pyridine ring, which is substituted at the 2, 4, 3, and 5 positions. The presence of the ethyl ester group contributes to its solubility in organic solvents, while the cyano and dichloro substituents enhance its reactivity and potential applications in synthetic chemistry. This compound is typically used in the synthesis of various pharmaceuticals and agrochemicals due to its ability to participate in nucleophilic substitution reactions. Its molecular structure suggests that it may exhibit biological activity, making it of interest in medicinal chemistry. Additionally, the dichloro groups can influence the compound's electronic properties, potentially affecting its interaction with biological targets. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, Ethyl 3,5-dichloro-4-cyano-2-pyridinecarboxylate is a versatile compound with significant implications in chemical research and development.
Formula:C9H6Cl2N2O2
InChI:InChI=1S/C9H6Cl2N2O2/c1-2-15-9(14)8-7(11)5(3-12)6(10)4-13-8/h4H,2H2,1H3
InChI key:InChIKey=QCDKAYLLFNQOQY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(Cl)C(C#N)=C(Cl)C=N1
Synonyms:
  • Ethyl 3,5-dichloro-4-cyano-2-pyridinecarboxylate
  • 2-Pyridinecarboxylic acid, 3,5-dichloro-4-cyano-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.