CAS 129618-40-2: Nevirapine
Description:Nevirapine is an antiretroviral medication primarily used in the treatment of HIV/AIDS. It belongs to the class of drugs known as non-nucleoside reverse transcriptase inhibitors (NNRTIs), which function by inhibiting the reverse transcriptase enzyme, thereby preventing viral replication. Nevirapine is characterized by its relatively low molecular weight and a specific chemical structure that includes a pyridine ring, contributing to its pharmacological activity. The substance is typically administered orally and is known for its rapid absorption and metabolism, primarily in the liver. Nevirapine is often used in combination with other antiretroviral agents to enhance therapeutic efficacy and reduce the risk of resistance development. Common side effects may include rash, liver toxicity, and gastrointestinal disturbances. Due to its potential for drug interactions, careful monitoring is essential when prescribed alongside other medications. Overall, Nevirapine plays a significant role in HIV treatment regimens, particularly in resource-limited settings, due to its affordability and effectiveness.
Formula:C15H14N4O
InChI:InChI=1S/C15H14N4O/c1-9-6-8-17-14-12(9)18-15(20)11-3-2-7-16-13(11)19(14)10-4-5-10/h2-3,6-8,10H,4-5H2,1H3,(H,18,20)
InChI key:InChIKey=NQDJXKOVJZTUJA-UHFFFAOYSA-N
SMILES:O=C1NC=2C(=NC=CC2C)N(C3=NC=CC=C13)C4CC4
- Synonyms:
- 11-Cyclopropyl-4-methylDipyrido[3,2-b:2′,3′-e][1,4]diazepin-6-one
- 11-Cyclopropyl-5,11-Dihydro-4-Methyl-6H-Dipyrido[3,2-B',3'-E][1,4]Diazepin-6-One
- 11-Cyclopropyl-5,11-Dihydro-4-Methyl-6H-Dipyrido[3,2-B:2',3'-E][1,4]Diazepin-6-One
- 11-Cyclopropyl-5,11-dihydro-4-methyl-6H-dipyrido[3,2-b:2′,3′-e][1,4]diazepin-6-one
- 11-cyclopropyl-4-methyl-5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one
- 5-Cyclopropyl-9-Methyl-5,10-Dihydro-4,5,6,10-Tetraaza-Dibenzo[A,D]Cyclohepten-11-One
- 6H-Dipyrido[3,2-B:2',3'-E][1,4]Diazepin-6-One, 11-Cyclopropyl-5,11-Dihydro-4-Methyl-
- 6H-Dipyrido[3,2-b:2′,3′-e][1,4]diazepin-6-one, 11-cyclopropyl-5,11-dihydro-4-methyl-
- Bi-Rg 587
- NSC 641530
- See more synonyms
- Nevarapine
- Nevirapine(Nvp)
- Novirapine
- Viramune
- Nevirapine