CAS 129618-62-8
:4-(Methylthio)-2-pyrimidinol
Description:
4-(Methylthio)-2-pyrimidinol is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of a methylthio group (-S-CH3) at the 4-position and a hydroxyl group (-OH) at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antiviral or antimicrobial agents. The compound's reactivity can be influenced by the electron-donating nature of the methylthio group, which can affect its interaction with other chemical species. Additionally, its stability and behavior under various conditions, such as pH and temperature, are important for its applications in synthesis and medicinal chemistry. As with many organic compounds, safety data should be consulted to ensure proper handling and usage.
Formula:C5H6N2OS
InChI:InChI=1S/C5H6N2OS/c1-9-4-2-3-6-5(8)7-4/h2-3H,1H3,(H,6,7,8)
InChI key:InChIKey=NALHPVUWRWEAQR-UHFFFAOYSA-N
SMILES:S(C)C1=NC(O)=NC=C1
Synonyms:- 4-(Methylthio)-2-pyrimidinol
- 2-Pyrimidinol, 4-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.