CymitQuimica logo

CAS 129619-37-0

:

(3R,6R)-3,6-Octanediol

Description:
(3R,6R)-3,6-Octanediol is a chiral organic compound characterized by its two hydroxyl (-OH) functional groups located at the 3rd and 6th carbon positions of an octane chain. This compound is a colorless, viscous liquid at room temperature and is soluble in water due to the presence of its hydroxyl groups, which can form hydrogen bonds. Its chirality, indicated by the (3R,6R) configuration, suggests that it exists in a specific stereoisomeric form, which can influence its reactivity and interactions in biological systems. (3R,6R)-3,6-Octanediol is often utilized in various applications, including as a building block in organic synthesis, in the formulation of cosmetics, and as a potential intermediate in the production of pharmaceuticals. Its physical properties, such as boiling point and melting point, are influenced by the molecular structure and the presence of functional groups, making it an interesting compound for both industrial and research purposes.
Formula:C8H18O2
InChI:InChI=1/C8H18O2/c1-3-7(9)5-6-8(10)4-2/h7-10H,3-6H2,1-2H3/t7-,8-/m1/s1
InChI key:BCKOQWWRTRBSGR-HTQZYQBOSA-N
SMILES:CC[C@H](CC[C@@H](CC)O)O
Synonyms:
  • (3R,6R)-Dihydroxyoctane
  • (3R,6R)-octane-3,6-diol
Found 5 products.