CAS 1296201-73-4

6-Bromo-N-[(3-methoxyphenyl)methyl]-1H-indole-2-carboxamide

Description:

6-Bromo-N-[(3-methoxyphenyl)methyl]-1H-indole-2-carboxamide is a chemical compound characterized by its indole core, which is a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position of the indole ring introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The N-[(3-methoxyphenyl)methyl] group indicates that there is a methoxy-substituted phenyl group attached via a methyl linker to the nitrogen atom of the carboxamide functional group. This structural arrangement suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The carboxamide functional group contributes to the compound's solubility and hydrogen bonding capabilities. Overall, this compound may exhibit unique pharmacological properties, and its specific characteristics, such as melting point, solubility, and biological activity, would depend on its molecular interactions and the presence of substituents. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₇H₁₅BrN₂O₂

InChI: InChI=1S/C17H15BrN2O2/c1-22-14-4-2-3-11(7-14)10-19-17(21)16-8-12-5-6-13(18)9-15(12)20-16/h2-9,20H,10H2,1H3,(H,19,21)

InChI key: InChIKey=VKDKPBDRNCRYIT-UHFFFAOYSA-N

SMILES: C(NCC1=CC(OC)=CC=C1)(=O)C2=CC=3C(N2)=CC(Br)=CC3

Synonyms:

• 1H-Indole-2-carboxamide, 6-bromo-N-[(3-methoxyphenyl)methyl]-
• 6-Bromo-N-[(3-methoxyphenyl)methyl]-1H-indole-2-carboxamide