CymitQuimica logo

CAS 1296223-96-5

:

6-Bromo-8-iodoimidazo[1,2-a]pyridine-2-carboxylic acid

Description:
6-Bromo-8-iodoimidazo[1,2-a]pyridine-2-carboxylic acid is a heterocyclic compound characterized by the presence of both bromine and iodine substituents on its imidazo[1,2-a]pyridine framework. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity in various chemical reactions. The imidazo[1,2-a]pyridine structure is known for its biological activity, making this compound of interest in medicinal chemistry and drug development. The presence of halogens, such as bromine and iodine, can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, the specific arrangement of atoms in this compound may affect its solubility, stability, and overall reactivity. As a result, 6-Bromo-8-iodoimidazo[1,2-a]pyridine-2-carboxylic acid may serve as a valuable intermediate in the synthesis of pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential applications.
Formula:C8H4BrIN2O2
InChI:InChI=1S/C8H4BrIN2O2/c9-4-1-5(10)7-11-6(8(13)14)3-12(7)2-4/h1-3H,(H,13,14)
InChI key:InChIKey=DFPQZPHSPLHPFK-UHFFFAOYSA-N
SMILES:IC=1C=2N(C=C(C(O)=O)N2)C=C(Br)C1
Synonyms:
  • Imidazo[1,2-a]pyridine-2-carboxylic acid, 6-bromo-8-iodo-
  • 6-Bromo-8-iodoimidazo[1,2-a]pyridine-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.