CAS 1296224-76-4

5-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-methyl-1H-pyrazole-3-carboxylic acid

Description:

5-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-methyl-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has an ester functionality, which can influence its solubility and stability. The methyl group at the 1-position of the pyrazole ring adds to its steric properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The CAS number 1296224-76-4 uniquely identifies this substance in chemical databases, facilitating its study and application in various scientific fields. Overall, the combination of functional groups and the pyrazole framework provides a basis for diverse chemical behavior and potential utility in various applications.

Formula: C₁₀H₁₅N₃O₄

InChI: InChI=1S/C10H15N3O4/c1-10(2,3)17-9(16)11-7-5-6(8(14)15)12-13(7)4/h5H,1-4H3,(H,11,16)(H,14,15)

InChI key: InChIKey=UYAAOOMCFKWSLZ-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=CC(C(O)=O)=NN1C

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]-1-methyl-
• 5-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-methyl-1H-pyrazole-3-carboxylic acid