CAS 1296225-21-2
:Methyl 4-[[(5-bromo-2-hydroxyphenyl)methylene]amino]-3-fluorobenzoate
Description:
Methyl 4-[[(5-bromo-2-hydroxyphenyl)methylene]amino]-3-fluorobenzoate is an organic compound characterized by its complex structure, which includes a methoxy group, a fluorine atom, and a brominated phenolic moiety. The presence of the methylene bridge linking the amino group to the 5-bromo-2-hydroxyphenyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. The fluorine atom introduces unique electronic properties, potentially enhancing the compound's lipophilicity and influencing its biological activity. The bromine substituent can also affect the compound's reactivity and stability. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, the combination of functional groups in this molecule suggests potential applications in drug development or as a chemical probe in biological studies.
Formula:C15H11BrFNO3
InChI:InChI=1S/C15H11BrFNO3/c1-21-15(20)9-2-4-13(12(17)7-9)18-8-10-6-11(16)3-5-14(10)19/h2-8,19H,1H3
InChI key:InChIKey=MVKPGHGMXQHCQC-UHFFFAOYSA-N
SMILES:C(=NC1=C(F)C=C(C(OC)=O)C=C1)C2=C(O)C=CC(Br)=C2
Synonyms:- Benzoic acid, 4-[[(5-bromo-2-hydroxyphenyl)methylene]amino]-3-fluoro-, methyl ester
- Methyl 4-[[(5-bromo-2-hydroxyphenyl)methylene]amino]-3-fluorobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.