CymitQuimica logo

CAS 1296225-22-3

:

Methyl 3-fluoro-4-[[(2-hydroxyphenyl)methylene]amino]benzoate

Description:
Methyl 3-fluoro-4-[[(2-hydroxyphenyl)methylene]amino]benzoate, identified by its CAS number 1296225-22-3, is an organic compound characterized by its complex structure, which includes a methyl ester group, a fluorine atom, and an amino linkage to a hydroxyphenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the fluorine atom can enhance lipophilicity and influence the compound's biological activity, while the hydroxyphenyl moiety may impart hydrogen bonding capabilities. Methyl esters are generally known for their moderate volatility and can participate in various chemical reactions, including hydrolysis and transesterification. The compound's specific applications may vary, but it could be of interest in medicinal chemistry or as a potential intermediate in organic synthesis. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C15H12FNO3
InChI:InChI=1S/C15H12FNO3/c1-20-15(19)10-6-7-13(12(16)8-10)17-9-11-4-2-3-5-14(11)18/h2-9,18H,1H3
InChI key:InChIKey=YFWMPZIAIBOEFT-UHFFFAOYSA-N
SMILES:N(=CC1=C(O)C=CC=C1)C2=C(F)C=C(C(OC)=O)C=C2
Synonyms:
  • Methyl 3-fluoro-4-[[(2-hydroxyphenyl)methylene]amino]benzoate
  • Benzoic acid, 3-fluoro-4-[[(2-hydroxyphenyl)methylene]amino]-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.