CAS 129623-52-5
:histidyl-aspartyl-glutamyl-leucine
Description:
Histidyl-aspartyl-glutamyl-leucine, identified by its CAS number 129623-52-5, is a peptide composed of four amino acids: histidine, aspartic acid, glutamic acid, and leucine. This peptide exhibits characteristics typical of polypeptides, including the ability to form secondary structures such as alpha-helices and beta-sheets, depending on its sequence and environmental conditions. The presence of histidine contributes to potential buffering capacity and metal ion binding, while aspartic and glutamic acids provide acidic properties due to their carboxyl groups. Leucine, being a hydrophobic amino acid, influences the peptide's overall hydrophobicity and stability. Peptides like this one can play significant roles in biological processes, including enzyme activity, signaling pathways, and structural functions in proteins. Additionally, their properties can be affected by factors such as pH, temperature, and the presence of other ions or molecules, which can influence their solubility and reactivity. Overall, histidyl-aspartyl-glutamyl-leucine is a versatile peptide with potential applications in biochemistry and pharmaceuticals.
Formula:C21H32N6O9
InChI:InChI=1/C21H32N6O9/c1-10(2)5-15(21(35)36)27-19(33)13(3-4-16(28)29)25-20(34)14(7-17(30)31)26-18(32)12(22)6-11-8-23-9-24-11/h8-10,12-15H,3-7,22H2,1-2H3,(H,23,24)(H,25,34)(H,26,32)(H,27,33)(H,28,29)(H,30,31)(H,35,36)/t12-,13-,14-,15-/m0/s1
Synonyms:- His-asp-glu-leu
- L-Leucine, N-(N-(N-L-histidyl-L-alpha-aspartyl)-L-alpha-glutamyl)-
- Hdel sequence
- N-(N-(N-L-Histidyl-L-alpha-aspartyl)-L-alpha-glutamyl)-L-leucine
- Histidyl-aspartyl-glutamyl-leucine
- L-histidyl-L-alpha-aspartyl-L-alpha-glutamyl-L-leucine
- L-Leucine, L-histidyl-L-α-aspartyl-L-α-glutamyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Histidyl-aspartyl-glutamyl-leucine
CAS:<p>HDEL intracellular distribution is characteristic of plant endoplasmic reticulum (ER).</p>Formula:C21H32N6O9Color and Shape:SolidMolecular weight:512.51
