CymitQuimica logo

CAS 129623-61-6

:

4-(4-FLUOROPHENOXY)BENZOIC ACID

Description:
4-(4-Fluorophenoxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a fluorophenoxy group. This compound features a fluorine atom substituted on one of the phenyl rings, enhancing its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, though its solubility in water is limited. The presence of the carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can influence its interactions in biological systems. Additionally, the fluorine atom can impart unique electronic properties, making it useful in the design of biologically active molecules. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid exposure. Overall, 4-(4-fluorophenoxy)benzoic acid is a compound of interest for its chemical properties and potential applications in various scientific domains.
Formula:C13H9FO3
InChI:InChI=1/C13H9FO3/c14-10-3-7-12(8-4-10)17-11-5-1-9(2-6-11)13(15)16/h1-8H,(H,15,16)
InChI key:YYKALFXKRWCSLY-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(=O)O)Oc1ccc(cc1)F
Found 4 products.