CAS 129644-56-0

2-NITRO-4-(TRIFLUOROMETHOXY)PHENOL

Description:

2-Nitro-4-(trifluoromethoxy)phenol is an organic compound characterized by the presence of a nitro group and a trifluoromethoxy group attached to a phenolic ring. Its molecular structure features a phenol moiety, which contributes to its potential as a weak acid due to the hydroxyl (-OH) group. The nitro group (-NO2) is an electron-withdrawing substituent that can enhance the compound's reactivity, particularly in electrophilic aromatic substitution reactions. The trifluoromethoxy group (-OCF3) significantly influences the compound's electronic properties, imparting high lipophilicity and altering its solubility in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, its unique combination of functional groups can lead to specific interactions in chemical reactions, influencing its stability and reactivity. Safety data should be consulted for handling, as compounds with nitro and trifluoromethyl functionalities can pose health and environmental risks.

Formula: C₇H₄F₃NO₄

InChI: InChI=1/C7H4F3NO4/c8-7(9,10)15-4-1-2-6(12)5(3-4)11(13)14/h1-3,12H

SMILES: c1cc(c(cc1OC(F)(F)F)N(=O)=O)O

Synonyms:

• Phenol, 2-Nitro-4-(Trifluoromethoxy)-

2-Nitro-4-(trifluoromethoxy)phenol

CAS: 129644-56-0

Formula: C₇H₄F₃NO₄

Molecular weight: 223.1062

Ref: IN-DA000Z97

2-Nitro-4-(trifluoromethoxy)phenol

CAS: 129644-56-0

2-Nitro-4-(trifluoromethoxy)phenol

Formula: C₇H₄F₃NO₄

Purity: ≥95%

Color and Shape: clear. light green to dark yellow liquid

Molecular weight: 223.11g/mol

Ref: 54-PC2782