CAS 129644-70-8
:2,3-DIMETHYL-4-(TRIFLUOROMETHYLTHIO)PHENOL
Description:
2,3-Dimethyl-4-(trifluoromethylthio)phenol is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of two methyl groups at the 2 and 3 positions and a trifluoromethylthio group at the 4 position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The trifluoromethylthio group enhances its reactivity and can influence its biological activity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Its molecular structure suggests potential for hydrogen bonding due to the hydroxyl group, which can affect its interactions with other molecules. Additionally, the trifluoromethyl group is known for imparting lipophilicity, which can influence the compound's behavior in biological systems. Safety data should be consulted for handling, as the trifluoromethylthio moiety may pose specific hazards. Overall, this compound exemplifies the complexity and versatility of substituted phenols in organic chemistry.
Formula:C9H9F3OS
InChI:InChI=1/C9H9F3OS/c1-5-6(2)8(4-3-7(5)13)14-9(10,11)12/h3-4,13H,1-2H3
SMILES:Cc1c(C)c(ccc1O)SC(F)(F)F
Synonyms:- 2,3-Dimethyl-4-Trifluoromethylsulfanyl-Phenol
- 2,4-Dimethyl-4-(trifluoromethylthio)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
