CAS 129655-21-6
:Bizelesin
Description:
Bizelesin, with the CAS number 129655-21-6, is a synthetic alkylating agent that belongs to the class of antitumor compounds. It is characterized by its ability to form covalent bonds with DNA, leading to the disruption of DNA replication and transcription, which ultimately induces cell death, particularly in rapidly dividing cancer cells. Bizelesin is known for its unique mechanism of action, which involves the formation of interstrand cross-links in DNA, making it effective against various types of tumors. The compound is typically administered in a clinical setting and has been studied for its potential use in cancer therapy. Its solubility and stability in biological systems are important factors that influence its efficacy and bioavailability. Additionally, like many chemotherapeutic agents, Bizelesin may exhibit side effects, which necessitate careful monitoring during treatment. Overall, its role in cancer treatment highlights the importance of targeted therapies in oncology.
Formula:C43H36Cl2N8O5
InChI:InChI=1/C43H36Cl2N8O5/c1-19-15-46-39-33(54)11-31-37(35(19)39)23(13-44)17-52(31)41(56)29-9-21-7-25(3-5-27(21)50-29)48-43(58)49-26-4-6-28-22(8-26)10-30(51-28)42(57)53-18-24(14-45)38-32(53)12-34(55)40-36(38)20(2)16-47-40/h3-12,15-16,23-24,46-47,50-51,54-55H,13-14,17-18H2,1-2H3,(H2,48,49,58)/t23-,24?/m1/s1
SMILES:Cc1c[nH]c2c(cc3c([C@H](CCl)CN3C(=O)c3cc4cc(ccc4[nH]3)NC(=O)Nc3ccc4c(c3)cc(C(=O)N3CC(CCl)c5c3cc(c3c5c(C)c[nH]3)O)[nH]4)c12)O
Synonyms:- Bizelesin [USAN:INN]
- 1,3-Bis(2-(((S)-1-(chloromethyl)-1,6-dihydro-5-hydroxy-8-methylbenzo(1,2-b:4,3-b')dipyrrol-3(2H)-yl)carbonyl)indol-5-yl)urea
- Benzo(1,2-b:4,3-b')dipyrrol-4-ol, 6,6'-(carbonylbis(imino-1H-indole-5,2-diylcarbonyl))bis(8-(chloromethyl)-3,6,7,8-tetrahydro-1-methyl-, (S-(R*,R*))-
- U-77,779
- Unii-L0O9Obi87E
- 1,3-bis(2-{[(1S)-1-(chloromethyl)-5-hydroxy-8-methyl-1,6-dihydropyrrolo[3,2-e]indol-3(2H)-yl]carbonyl}-1H-indol-5-yl)urea
- 1-(2-{[(1S)-1-(chloromethyl)-5-hydroxy-8-methyl-1,6-dihydropyrrolo[3,2-e]indol-3(2H)-yl]carbonyl}-1H-indol-5-yl)-3-(2-{[1-(chloromethyl)-5-hydroxy-8-methyl-1,6-dihydropyrrolo[3,2-e]indol-3(2H)-yl]carbonyl}-1H-indol-5-yl)urea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Bizelesin
CAS:Bizelesin is a benzoic acid derivative that has surfactant properties. It has been shown to have anti-cancer activity, specifically against breast and ovarian cancer cells. Bizelesin works by binding to DNA and inhibiting the transcription of genes involved in cell proliferation. This drug can also inhibit c-Met, a receptor tyrosine kinase that is involved in cell growth and survival. Bizelesin can be extracted from natural sources or synthesized chemically. It has been immobilized onto various surfaces, including magnetic nanoparticles and silica gel, for use in drug delivery systems. Additionally, bizelesin has been used as a substrate for enzymes such as amidase and acylase, which can convert it into other compounds with potential therapeutic applications.Formula:C43H36Cl2N8O5Purity:Min. 95%Molecular weight:815.7 g/molBizelesin
CAS:Bizelesin, a synthetic antineoplastic agent, binds DNA, disrupts replication, triggers cell-cycle arrest, and induces senescence.Formula:C43H36Cl2N8O5Color and Shape:SolidMolecular weight:815.7


