CAS 129655-37-4

1H-Indole-2-carboxylic acid, 5,5′-(carbonyldiimino)bis-

Description:

1H-Indole-2-carboxylic acid, 5,5′-(carbonyldiimino)bis- is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a carboxylic acid functional group at the 2-position of the indole, contributing to its acidic properties. The presence of the carbonyldiimino moiety indicates that it contains two imine groups linked by a carbonyl group, which can influence its reactivity and potential applications in organic synthesis or medicinal chemistry. The compound may exhibit biological activity due to the indole core, which is known for its presence in various natural products and pharmaceuticals. Its solubility, stability, and reactivity can vary depending on the specific conditions and the presence of other functional groups. Overall, this compound represents a complex structure with potential implications in chemical research and development.

Formula: C₁₉H₁₄N₄O₅

InChI: InChI=1S/C19H14N4O5/c24-17(25)15-7-9-5-11(1-3-13(9)22-15)20-19(28)21-12-2-4-14-10(6-12)8-16(23-14)18(26)27/h1-8,22-23H,(H,24,25)(H,26,27)(H2,20,21,28)

InChI key: InChIKey=ATFRLAFCRGJKAA-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=2C(N1)=CC=C(NC(NC=3C=C4C(=CC3)NC(C(O)=O)=C4)=O)C2

Synonyms:

• 1H-Indole-2-carboxylic acid, 5,5′-(carbonyldiimino)bis-

5,5'-(Carbonyldiimino)bis-1H-Indole-2-carboxylic Acid

Controlled Product

CAS: 129655-37-4

Applications 5,5'-(Carbonyldiimino)bis-1H-Indole-2-carboxylic Acid structure is made up of indole-2-carboxylic acid esters. The structure of Indole-2-carboxylic acid esters has biological function a multitude of methods exist for the synthesis of these compounds.
References Gu, L., et al.: J. Braz. chem., 22, 2036 (2011),

Formula: C₁₉H₁₄N₄O₅

Color and Shape: Neat

Molecular weight: 378.338

Ref: TR-C129650