CAS 129660-17-9
:3,3-Dinitroazetidine
Description:
3,3-Dinitroazetidine is a chemical compound characterized by its unique structure, which includes a four-membered azetidine ring substituted with two nitro groups at the 3-position. This compound is notable for its energetic properties, making it of interest in the field of explosives and propellants. The presence of nitro groups contributes to its high energy content and potential reactivity. 3,3-Dinitroazetidine is typically a solid at room temperature and may exhibit sensitivity to heat, shock, or friction, which is common among nitro-substituted compounds. Its synthesis involves specific chemical reactions that introduce the nitro groups onto the azetidine framework. Due to its energetic nature, handling and storage require careful consideration of safety protocols to mitigate risks associated with its potential for detonation or combustion. Additionally, research into its applications may focus on optimizing its performance in various formulations while ensuring stability and safety in practical use.
Formula:C3H5N3O4
InChI:InChI=1S/C3H5N3O4/c7-5(8)3(6(9)10)1-4-2-3/h4H,1-2H2
InChI key:InChIKey=DROLGCKUCMGNSF-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1(N(=O)=O)CNC1
Synonyms:- 3,3-Dinitroazetidine
- Azetidine, 3,3-dinitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
