CAS 129663-08-7
:3-(triethoxysilyl)pyridine
Description:
3-(Triethoxysilyl)pyridine is an organosilicon compound characterized by the presence of a pyridine ring and triethoxysilyl functional groups. This compound typically exhibits a pale yellow to colorless liquid form and is soluble in organic solvents, while being less soluble in water due to the hydrophobic nature of the silane group. The triethoxysilyl moiety allows for the potential to form siloxane bonds with various substrates, making it useful as a coupling agent or surface modifier in materials science and coatings. The pyridine ring contributes to its basicity and potential reactivity, enabling it to participate in various chemical reactions, including coordination with metal ions. Additionally, this compound can enhance adhesion properties and improve the durability of composite materials. Its applications span across fields such as adhesives, sealants, and surface treatments, where it can improve the performance of polymers and other materials. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C11H19NO3Si
InChI:InChI=1/C11H19NO3Si/c1-4-13-16(14-5-2,15-6-3)11-8-7-9-12-10-11/h7-10H,4-6H2,1-3H3
SMILES:CCO[Si](c1cccnc1)(OCC)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
