CymitQuimica logo

CAS 129670-05-9

:

4-(2-CHLORO-1,1,2-TRIFLUOROETHOXY)-2-METHYL-PHENOL

Description:
4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-phenol, with the CAS number 129670-05-9, is an organic compound characterized by its complex structure, which includes a phenolic group substituted with a chloro and a trifluoroethoxy moiety. This compound typically exhibits properties associated with both aromatic and halogenated compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the chloro and trifluoroethyl groups. The trifluoromethyl group can impart unique electronic properties, influencing the compound's behavior in chemical reactions and its interactions with biological systems. Additionally, the presence of the hydroxyl group (from the phenol) suggests potential for hydrogen bonding, which can affect its solubility and reactivity. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C9H8ClF3O2
InChI:InChI=1/C9H8ClF3O2/c1-5-4-6(2-3-7(5)14)15-9(12,13)8(10)11/h2-4,8,14H,1H3
SMILES:Cc1cc(ccc1O)OC(C(Cl)F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.