CymitQuimica logo

CAS 129672-23-7

:

(6aR,13bS)-11-chloro-6,6a,7,8,9,13b-hexahydro-5H-benzo[d]naphtho[2,1-b]azepin-12-ol

Description:
The chemical substance known as (6aR,13bS)-11-chloro-6,6a,7,8,9,13b-hexahydro-5H-benzo[d]naphtho[2,1-b]azepin-12-ol, with the CAS number 129672-23-7, is a complex organic compound characterized by its unique bicyclic structure that incorporates both a benzo and naphtho moiety. This compound features a chloro substituent, which can influence its reactivity and biological activity. The stereochemistry indicated by the (6aR,13bS) designation suggests specific spatial arrangements of atoms, which can significantly affect the compound's pharmacological properties. As a hexahydro derivative, it possesses multiple saturated carbon rings, contributing to its stability and potential interactions with biological targets. The presence of a hydroxyl group (-OH) indicates that it may exhibit polar characteristics, enhancing its solubility in polar solvents. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development, due to their structural complexity and potential biological activity.
Formula:C18H18ClNO
InChI:InChI=1/C18H18ClNO/c19-15-9-12-7-8-20-16-6-5-11-3-1-2-4-13(11)18(16)14(12)10-17(15)21/h1-4,9-10,16,18,20-21H,5-8H2/t16-,18+/m1/s1
InChI key:InChIKey=NVHUFRKDLSFBFZ-PWQNQZOANA-N
SMILES:OC=1C=C2[C@]3(C=4C(CC[C@@]3(NCCC2=CC1Cl)[H])=CC=CC4)[H]
Synonyms:
  • 5H-Benzo[d]naphth[2,1-b]azepin-12-ol, 11-chloro-6,6a,7,8,9,13b-hexahydro-, trans-
  • See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.