CymitQuimica logo

CAS 129674-17-5

:

4-Aminobenzenesulfonic acid homopolymer

Description:
4-Aminobenzenesulfonic acid homopolymer, identified by its CAS number 129674-17-5, is a synthetic polymer characterized by its sulfonic acid and amino functional groups. This polymer is typically water-soluble, which enhances its utility in various applications, particularly in the fields of dyes, pigments, and as a dispersing agent. The presence of the sulfonic acid group imparts strong acidic properties, making it effective in ion exchange processes and as a stabilizer in colloidal systems. Additionally, the amino group can participate in various chemical reactions, allowing for further functionalization and modification of the polymer. Its structural characteristics contribute to its potential use in pharmaceuticals, as well as in the formulation of coatings and adhesives. The polymer's properties, such as thermal stability and mechanical strength, can vary based on its molecular weight and degree of sulfonation, making it versatile for different industrial applications. Overall, 4-Aminobenzenesulfonic acid homopolymer is valued for its functional groups that enable a range of chemical interactions and applications.
Formula:(C6H7NO3S)x
InChI:InChI=1S/C6H7NO3S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,7H2,(H,8,9,10)
InChI key:InChIKey=HVBSAKJJOYLTQU-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC=C(N)C=C1
Synonyms:
  • Benzenesulfonic acid, 4-amino-, homopolymer
  • Poly(p-aminobenzenesulfonic acid)
  • 4-Aminobenzenesulfonic acid homopolymer
  • p-Aminobenzenesulfonic acid homopolymer
  • Poly(sulfanilic acid)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.