CAS 129686-16-4

6-Bromo-3,4-dihydro-1H-[1,8]naphthyridin-2-one

Description:

6-Bromo-3,4-dihydro-1H-[1,8]naphthyridin-2-one is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a bromine substituent at the 6-position and a carbonyl group at the 2-position, contributing to its reactivity and potential biological activity. The presence of the dihydro group indicates that it has a saturated ring system, which can influence its physical properties, such as solubility and stability. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for various interactions with biological targets, potentially leading to applications in drug development. Additionally, the compound's CAS number, 129686-16-4, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical databases. Overall, 6-Bromo-3,4-dihydro-1H-[1,8]naphthyridin-2-one represents a significant class of compounds with diverse applications in chemistry and pharmacology.

Formula: C₈H₇BrN₂O

InChI: InChI=1/C8H7BrN2O/c9-6-3-5-1-2-7(12)11-8(5)10-4-6/h3-4H,1-2H2,(H,10,11,12)

SMILES: C1CC(=Nc2c1cc(cn2)Br)O

Synonyms:

• 6-Bromo-3,4-Dihydro-1,8-Naphthyridin-2(1H)-One
• 6-Bromo-3,4-dihydro-1,8-naphthyridin-2(1H)-on
• 6-Bromo-3,4-dihydro-1H-[1,8]naphthyrid-2-one

1,8-Naphthyridin-2(1H)-one, 6-bromo-3,4-dihydro-

CAS: 129686-16-4

Formula: C₈H₇BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 227.0580

Ref: IN-DA000TKS

6-Bromo-3,4-dihydro-1,8-naphthyridin-2(1H)-one

CAS: 129686-16-4

6-Bromo-3,4-dihydro-1,8-naphthyridin-2(1H)-one

Formula: C₈H₇BrN₂O

Purity: 97%

Color and Shape: light gold/faint orange powder

Molecular weight: 227.06g/mol

Ref: 54-OR16671

6-Bromo-3,4-dihydro-1H-[1,8]naphthyridin-2-one

CAS: 129686-16-4

Formula: C₈H₇BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 227.061

Ref: 10-F076293

6-Bromo-3,4-dihydro-1H-[1,8]naphthyridin-2-one

Controlled Product

CAS: 129686-16-4

Applications 6-Bromo-3,4-dihydro-1H-[1,8]naphthyridin-2-one (cas# 129686-16-4) is a compound useful in organic synthesis.

Formula: C₈H₇BrN₂O

Color and Shape: Off-White To Yellow

Molecular weight: 227.06

Ref: TR-B684035