CAS 129689-30-1
:2-[4-[2-[[(2S)-2-Hydroxy-3-phenoxypropyl]amino]ethoxy]phenoxy]-N-(2-methoxyethyl)acetamide
Description:
The chemical substance known as 2-[4-[2-[[(2S)-2-Hydroxy-3-phenoxypropyl]amino]ethoxy]phenoxy]-N-(2-methoxyethyl)acetamide, with the CAS number 129689-30-1, is a synthetic compound characterized by its complex structure, which includes multiple functional groups such as amines, ethers, and phenolic moieties. This compound is typically categorized as a pharmaceutical agent, often investigated for its potential therapeutic applications. Its molecular structure suggests it may exhibit properties such as solubility in organic solvents and moderate polarity, which can influence its bioavailability and interaction with biological systems. The presence of the hydroxy and methoxy groups may contribute to its reactivity and ability to form hydrogen bonds, potentially enhancing its pharmacological activity. Additionally, the stereochemistry indicated by the (2S) configuration suggests that it may have specific interactions with biological targets, which is crucial for its efficacy. Overall, this compound's unique characteristics make it a subject of interest in medicinal chemistry and drug development.
Formula:C22H30N2O6
InChI:InChI=1S/C22H30N2O6/c1-27-13-12-24-22(26)17-30-21-9-7-20(8-10-21)28-14-11-23-15-18(25)16-29-19-5-3-2-4-6-19/h2-10,18,23,25H,11-17H2,1H3,(H,24,26)/t18-/m0/s1
InChI key:InChIKey=RVMBDLSFFNKKLG-SFHVURJKSA-N
SMILES:O(CC(NCCOC)=O)C1=CC=C(OCCNC[C@@H](COC2=CC=CC=C2)O)C=C1
Synonyms:- (S)-Oxyethyl)
- 2-[4-(2-{[(2S)-2-hydroxy-3-phenoxypropyl]amino}ethoxy)phenoxy]-N-(2-methoxyethyl)acetamide
- Acetamide, 2-[4-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]-N-(2-methoxyethyl)-, (S)-
- Acetamide, 2-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethoxy]phenoxy]-N-(2-methoxyethyl)-
- Acetamide,2-(4-(2-((2-Hydroxy-3-Phenoxypropyl)Amino)Ethoxy)Phenoxy)-N-(2-Meth
- Ici-D 7114
- Ici-D7114
- Icid7114
- Zd 7114
- Zd 7114 Hydrochloride
- Zd7114
- Zeneca ZD 7114
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Acetamide, 2-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethoxy]phenoxy]-N-(2-methoxyethyl)-
CAS:Formula:C22H30N2O6Molecular weight:418.4834ZD7114 free base
CAS:ZD7114 (ICI-D7114) selectively activates brown fat, boosts thermogenesis, and aids in obesity and metabolic disorders.Formula:C22H30N2O6Color and Shape:SolidMolecular weight:418.48

