CAS 129716-11-6
:4-CHLORO-2-METHYLBENZYL ALCOHOL 97
Description:
4-Chloro-2-methylbenzyl alcohol, with the CAS number 129716-11-6, is an organic compound characterized by the presence of a chlorinated aromatic ring and a hydroxyl functional group. This compound features a chloro substituent at the para position and a methyl group at the ortho position relative to the hydroxyl group on the benzyl moiety. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxyl group imparts alcohol-like properties, making it soluble in polar solvents such as water and alcohols, while the aromatic structure contributes to its hydrophobic characteristics. This compound may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its reactivity can be influenced by the electron-withdrawing nature of the chlorine atom, which can affect its behavior in chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Proper handling and storage are essential due to potential toxicity and environmental impact.
Formula:C8H9ClO
InChI:InChI=1/C8H9ClO/c1-6-4-8(9)3-2-7(6)5-10/h2-4,10H,5H2,1H3
SMILES:Cc1cc(ccc1CO)Cl
Synonyms:- (4-Chloro-2-methylphenyl)methanol
- Benzenemethanol, 4-chloro-2-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Chloro-2-methylbenzyl Alcohol
CAS:Formula:C8H9ClOPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:156.61Benzenemethanol, 4-chloro-2-methyl-
CAS:Formula:C8H9ClOPurity:95%Color and Shape:SolidMolecular weight:156.60954-Chloro-2-methylbenzyl alcohol
CAS:4-Chloro-2-methylbenzyl alcoholPurity:98%Molecular weight:156.61g/mol4-Chloro-2-methylbenzyl alcohol
CAS:4-Chloro-2-methylbenzyl alcohol is an organic compound that has a sensor and hydroxyl group. It is used in pest control as an insecticide. 4-Chloro-2-methylbenzyl alcohol has been shown to be effective against ants, cockroaches, and other insects. There are multiple instabilities of this compound, including low oxygen stability when exposed to air, which may lead to the degradation of this chemical. Impurities in 4-chloro-2-methylbenzyl alcohol may also lead to its instability as it reacts with alkali metals at high temperatures. The instability of 4-chloro-2-methylbenzyl alcohol can be reduced by storing it at low temperatures or by adding cryogenic substances such as liquid nitrogen or carbon dioxide gas.
Formula:C8H9ClOPurity:Min. 95%Molecular weight:156.61 g/mol4-Chloro-2-methylbenzyl alcohol
CAS:Formula:C8H9ClOPurity:95%Color and Shape:LiquidMolecular weight:156.61




