CAS 1297262-16-8

Benzoic acid, 4-[3,5-bis[(1E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-1H-pyrazol-1-yl]-, sodium salt (1:1)

Description:

Benzoic acid, 4-[3,5-bis[(1E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-1H-pyrazol-1-yl]-, sodium salt (1:1) is a complex organic compound characterized by its structural features, which include a benzoic acid moiety and a pyrazole ring substituted with vinyl groups. The presence of hydroxyl and methoxy groups on the phenyl rings contributes to its potential for hydrogen bonding and influences its solubility and reactivity. As a sodium salt, it is likely to exhibit increased solubility in aqueous environments compared to its acid form. This compound may possess biological activity, potentially acting as an anti-inflammatory or antioxidant agent, owing to the presence of the pyrazole and phenolic structures. Its molecular interactions can be influenced by pH, temperature, and solvent conditions, making it relevant in various chemical and pharmaceutical applications. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or detailed literature reference for precise characterization.

Formula: C₂₈H₂₄N₂O₆·Na

InChI: InChI=1S/C28H24N2O6.Na/c1-35-26-15-18(5-13-24(26)31)3-9-21-17-23(10-4-19-6-14-25(32)27(16-19)36-2)30(29-21)22-11-7-20(8-12-22)28(33)34;/h3-17,31-32H,1-2H3,(H,33,34);/b9-3+,10-4+;

InChI key: InChIKey=JOSUOVSOSLHPCP-RUACYTINSA-N

SMILES: C(=C/C1=CC(OC)=C(O)C=C1)\C=2N(N=C(/C=C/C3=CC(OC)=C(O)C=C3)C2)C4=CC=C(C(O)=O)C=C4.[Na]

Synonyms:

• Benzoic acid, 4-[3,5-bis[(1E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-1H-pyrazol-1-yl]-, sodium salt (1:1)
• CTK 7A

CTK7A

CAS: 1297262-16-8

CTK7A is a water-soluble inhibitor of p300. CTK7A inhibits tumor growth in xenografted mice.

Formula: C₂₈H₂₄N₂NaO₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 507.498

Ref: TM-T27096