
CAS 1297537-35-9
:2-Chloro-4-[1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl]benzonitrile
Description:
2-Chloro-4-[1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl]benzonitrile is a chemical compound characterized by its complex structure, which includes a chloro substituent, a benzonitrile moiety, and a pyrazole ring linked to a tetrahydro-2H-pyran group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the chloro and nitrile functional groups. The tetrahydro-2H-pyran moiety may contribute to its overall stability and influence its interaction with biological targets, making it of interest in medicinal chemistry. The presence of the pyrazole ring suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-inflammatory or analgesic properties. Additionally, the compound's molecular structure may allow for various synthetic modifications, enhancing its utility in research and development. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogenated and nitrile functionalities.
Formula:C15H14ClN3O
InChI:InChI=1S/C15H14ClN3O/c16-13-9-11(4-5-12(13)10-17)14-6-7-18-19(14)15-3-1-2-8-20-15/h4-7,9,15H,1-3,8H2
InChI key:InChIKey=NLPVLRRBVJWADT-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=2N(N=CC2)C3CCCCO3)C=CC1C#N
Synonyms:- Benzonitrile, 2-chloro-4-[1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl]-
- 2-Chloro-4-[1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazol-5-yl]benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.