CAS 1297537-41-7

4-[1-[(2S)-2-Aminopropyl]-1H-pyrazol-3-yl]-2-chlorobenzonitrile

Description:

4-[1-[(2S)-2-Aminopropyl]-1H-pyrazol-3-yl]-2-chlorobenzonitrile is a chemical compound characterized by its complex structure, which includes a chlorobenzonitrile moiety and a pyrazole ring substituted with an amino group. This compound features a chiral center due to the presence of the (2S)-2-aminopropyl group, which can influence its biological activity and interactions. The chlorobenzonitrile part contributes to its potential as a pharmaceutical agent, as halogenated aromatic compounds often exhibit significant biological properties. The pyrazole ring is known for its presence in various bioactive compounds, including anti-inflammatory and analgesic agents. The presence of the amino group may enhance solubility and reactivity, making it a candidate for further chemical modifications. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents targeting specific biological pathways.

Formula: C₁₃H₁₃ClN₄

InChI: InChI=1S/C13H13ClN4/c1-9(16)8-18-5-4-13(17-18)10-2-3-11(7-15)12(14)6-10/h2-6,9H,8,16H2,1H3/t9-/m0/s1

InChI key: InChIKey=MQWGPHFTKXGETE-VIFPVBQESA-N

SMILES: C([C@H](C)N)N1N=C(C=C1)C2=CC(Cl)=C(C#N)C=C2

Synonyms:

• Benzonitrile, 4-[1-[(2S)-2-aminopropyl]-1H-pyrazol-3-yl]-2-chloro-
• (S)-4-[1-(2-Aminopropyl)-1H-pyrazol-3-yl]-2-chlorobenzonitrile
• 4-[1-[(2S)-2-Aminopropyl]-1H-pyrazol-3-yl]-2-chlorobenzonitrile

Benzonitrile, 4-[1-[(2S)-2-aminopropyl]-1H-pyrazol-3-yl]-2-chloro-

CAS: 1297537-41-7

Formula: C₁₃H₁₃ClN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 260.7221

Ref: IN-DA01Q6Y0

(S)-4-(1-(2-Aminopropyl)-1H-pyrazol-3-yl)-2-chlorobenzonitrile

CAS: 1297537-41-7

(S)-4-(1-(2-Aminopropyl)-1H-pyrazol-3-yl)-2-chlorobenzonitrile

Purity: 98%

Molecular weight: 260.73g/mol

Ref: 54-OR1068382