CAS 1297537-45-1

3-Acetyl-1H-pyrazole-5-carboxylic acid

Description:

3-Acetyl-1H-pyrazole-5-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an acetyl group and a carboxylic acid functional group, contributing to its reactivity and potential applications in various chemical reactions. The presence of the carboxylic acid group allows for hydrogen bonding and increases the compound's solubility in polar solvents. Additionally, the acetyl group can participate in acylation reactions, making it useful in synthetic organic chemistry. The compound's unique structure may also impart specific biological activities, making it of interest in pharmaceutical research. Its CAS number, 1297537-45-1, is a unique identifier that facilitates the tracking and study of this substance in scientific literature and databases. Overall, 3-Acetyl-1H-pyrazole-5-carboxylic acid is a versatile compound with potential applications in both synthetic and medicinal chemistry.

Formula: C₆H₆N₂O₃

InChI: InChI=1S/C6H6N2O3/c1-3(9)4-2-5(6(10)11)8-7-4/h2H,1H3,(H,7,8)(H,10,11)

InChI key: InChIKey=HFBWRCZRDIVAMQ-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC(C(O)=O)=NN1

Synonyms:

• 3-Acetyl-1H-pyrazole-5-carboxylic acid
• 5-Acetyl-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 5-acetyl-

1H-Pyrazole-3-carboxylic acid, 5-acetyl-

CAS: 1297537-45-1

Formula: C₆H₆N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.1234

Ref: IN-DA000TMP

5-Acetyl-1H-pyrazole-3-carboxylic acid

CAS: 1297537-45-1

5-Acetyl-1H-pyrazole-3-carboxylic acid

Purity: 98%

Molecular weight: 154.12g/mol

Ref: 54-OR89860

Darolutamide Impurity 11

CAS: 1297537-45-1

Formula: C₆H₆N₂O₃

Molecular weight: 154.12

Ref: 4Z-D-245014

3-Acetyl-1H-pyrazole-5-carboxylic acid

CAS: 1297537-45-1

Formula: C₆H₆N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.125

Ref: 10-F239365