CAS 1297538-32-9: N-[(1S)-2-[3-(3-Chloro-4-cyanophenyl)-1H-pyrazol-1-yl]-1-methylethyl]-5-(1-hydroxyethyl)-1H-pyrazole-3-carboxamide
Description:N-[(1S)-2-[3-(3-Chloro-4-cyanophenyl)-1H-pyrazol-1-yl]-1-methylethyl]-5-(1-hydroxyethyl)-1H-pyrazole-3-carboxamide, with CAS number 1297538-32-9, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as pyrazole rings and a carboxamide moiety. This compound exhibits properties typical of pyrazole derivatives, including potential biological activity, which may be attributed to its ability to interact with various biological targets. The presence of a chloro and a cyano group suggests that it may possess significant lipophilicity, influencing its solubility and permeability. Additionally, the hydroxyl group contributes to its potential for hydrogen bonding, which can affect its reactivity and interaction with other molecules. Such compounds are often studied for their pharmacological properties, including anti-inflammatory or anti-cancer activities. However, specific biological activities and applications would require further investigation through experimental studies and clinical trials.
Formula:C19H19ClN6O2
InChI:InChI=1S/C19H19ClN6O2/c1-11(22-19(28)18-8-17(12(2)27)23-24-18)10-26-6-5-16(25-26)13-3-4-14(9-21)15(20)7-13/h3-8,11-12,27H,10H2,1-2H3,(H,22,28)(H,23,24)/t11-,12?/m0/s1
InChI key:InChIKey=BLIJXOOIHRSQRB-PXYINDEMSA-N
SMILES:N#CC=1C=CC(=CC1Cl)C2=NN(C=C2)CC(NC(=O)C3=NNC(=C3)C(O)C)C
- Synonyms:
- 1H-Pyrazole-3-carboxamide, N-[(1S)-2-[3-(3-chloro-4-cyanophenyl)-1H-pyrazol-1-yl]-1-methylethyl]-5-(1-hydroxyethyl)-
- BAY 1841788
- ODM 201
- N-[(1S)-2-[3-(3-Chloro-4-cyanophenyl)-1H-pyrazol-1-yl]-1-methylethyl]-5-(1-hydroxyethyl)-1H-pyrazole-3-carboxamide
- Darolutamide