
CAS 1297654-75-1
:8-Chloro-6-methyl-3-quinolinamine
Description:
8-Chloro-6-methyl-3-quinolinamine is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. The presence of a chlorine atom at the 8-position and a methyl group at the 6-position of the quinoline ring contributes to its unique chemical properties. This compound is classified as an amine due to the amino group (-NH2) located at the 3-position, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The chlorine substituent may enhance the compound's reactivity and influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents. Its solubility, stability, and reactivity can vary based on the surrounding environment, including pH and solvent polarity. Overall, 8-Chloro-6-methyl-3-quinolinamine represents a versatile scaffold for further chemical modifications and research in drug development.
Formula:C10H9ClN2
InChI:InChI=1S/C10H9ClN2/c1-6-2-7-4-8(12)5-13-10(7)9(11)3-6/h2-5H,12H2,1H3
InChI key:InChIKey=TVCNGXIAXZMDIX-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(C)C1)C=C(N)C=N2
Synonyms:- 8-Chloro-6-methyl-3-quinolinamine
- 3-Quinolinamine, 8-chloro-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.