CAS 129768-29-2
:5-(Trifluoromethyl)-1H-pyrazole-3-carbonyl chloride
Description:
5-(Trifluoromethyl)-1H-pyrazole-3-carbonyl chloride is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a trifluoromethyl group and a carbonyl chloride functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity, particularly due to the presence of the carbonyl chloride group, which can participate in nucleophilic substitution reactions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, this compound may exhibit properties such as high thermal stability and volatility, which are important for its handling and storage. Safety precautions are necessary when working with this substance, as it may be toxic and can release harmful gases upon decomposition. Overall, 5-(Trifluoromethyl)-1H-pyrazole-3-carbonyl chloride is a versatile compound with significant implications in various chemical research fields.
Formula:C5H2ClF3N2O
InChI:InChI=1S/C5H2ClF3N2O/c6-4(12)2-1-3(11-10-2)5(7,8)9/h1H,(H,10,11)
InChI key:InChIKey=LQSQXCJJVUVZRA-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C(Cl)=O)=NN1
Synonyms:- 1H-Pyrazole-3-carbonyl chloride, 5-(trifluoromethyl)-
- 5-(Trifluoromethyl)-1H-pyrazole-3-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
