CAS 129768-48-5
:2-[(2-CHLOROPROPANOYL)AMINO]BENZAMIDE
Description:
2-[(2-Chloropropanoyl)amino]benzamide, with the CAS number 129768-48-5, is an organic compound characterized by its amide functional group and a chloropropanoyl substituent. This compound features a benzamide structure, where an amino group is attached to a benzene ring, and a 2-chloropropanoyl group is linked to the nitrogen atom of the amide. The presence of the chlorine atom introduces unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of both hydrophilic amide and chloropropanoyl groups. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where the chloropropanoyl moiety may contribute to biological activity. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, 2-[(2-Chloropropanoyl)amino]benzamide represents a versatile chemical entity with potential utility in various fields.
Formula:C10H11ClN2O2
InChI:InChI=1/C10H11ClN2O2/c1-6(11)10(15)13-8-5-3-2-4-7(8)9(12)14/h2-6H,1H3,(H2,12,14)(H,13,15)
SMILES:CC(C(=Nc1ccccc1C(=N)O)O)Cl
Synonyms:- 2-{[(2S)-2-chloropropanoyl]amino}benzamide
- 2-{[(2R)-2-chloropropanoyl]amino}benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzamide, 2-[(2-chloro-1-oxopropyl)amino]-, (S)- (9CI)
CAS:Formula:C10H11ClN2O2Molecular weight:226.6595
