CAS 129785-44-0
:2-acetamido-1,3,6-tri-O-acetyl-4-deoxy-4-fluoroglucopyranose
Description:
2-Acetamido-1,3,6-tri-O-acetyl-4-deoxy-4-fluoroglucopyranose is a synthetic derivative of glucopyranose, characterized by the presence of an acetamido group and multiple acetyl groups on the sugar structure. The fluorine substitution at the 4-position enhances its chemical reactivity and can influence its biological activity. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as methanol and dichloromethane, but may have limited solubility in water due to its acetyl groups. The presence of the acetamido group suggests potential applications in medicinal chemistry, particularly in the development of glycosylated compounds. Its structural modifications can affect its interaction with biological systems, making it a candidate for further research in drug design and carbohydrate chemistry. Additionally, the compound's stability and reactivity can be influenced by the acetylation pattern, which may be relevant in various synthetic pathways or applications in glycoscience.
Formula:C14H20FNO8
InChI:InChI=1/C14H20FNO8/c1-6(17)16-12-13(22-8(3)19)11(15)10(5-21-7(2)18)24-14(12)23-9(4)20/h10-14H,5H2,1-4H3,(H,16,17)/t10-,11-,12-,13+,14+/m1/s1
Synonyms:- 2-(Acetylamino)-2,4-dideoxy-4-fluoro-alpha-D-glucopyranose 1,3,6-triacetate
- 2-Acetamido-1,3,6-tri-O-acetyl-4-deoxy-4-fluoro-alpha-D-glucopyranose
- 4-F-Glcnac
- alpha-D-Glucopyranose, 2-(acetylamino)-2,4-dideoxy-4-fluoro-, 1,3,6-triacetate
- 1,3,6-tri-O-acetyl-2-(acetylamino)-2,4-dideoxy-4-fluoro-alpha-D-glucopyranose
- 2-Acetamido-1,3,6-tri-O-acetyl-4-deoxy-4-fluoroglucopyranose
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
α-D-Glucopyranose, 2-(acetylamino)-2,4-dideoxy-4-fluoro-, 1,3,6-triacetate
CAS:Formula:C14H20FNO8Molecular weight:349.3089
