CAS 129787-66-2: fluorescein di-(B-D-glucopyranoside)
Description:Fluorescein di-(B-D-glucopyranoside) is a fluorescent compound characterized by its structure, which includes a fluorescein moiety linked to two β-D-glucopyranoside units. This compound exhibits strong fluorescence properties, making it useful in various biological and chemical applications, particularly in fluorescence microscopy and as a tracer in biological systems. The glucopyranoside groups enhance its solubility in aqueous environments and can facilitate cellular uptake, allowing for effective labeling of cells or biomolecules. The presence of the glucopyranoside units also contributes to its biocompatibility, making it suitable for use in biological assays. Additionally, fluorescein derivatives are known for their stability under a range of conditions, although they can be sensitive to pH changes and light exposure. Overall, fluorescein di-(B-D-glucopyranoside) serves as a valuable tool in research and diagnostic applications, particularly in the fields of biochemistry and molecular biology.
Formula:C32H32O15
InChI:InChI=1/C32H32O15/c33-11-21-23(35)25(37)27(39)30(45-21)42-13-5-7-17-19(9-13)44-20-10-14(43-31-28(40)26(38)24(36)22(12-34)46-31)6-8-18(20)32(17)16-4-2-1-3-15(16)29(41)47-32/h1-10,21-28,30-31,33-40H,11-12H2/t21-,22-,23-,24-,25+,26+,27-,28-,30-,31-/m1/s1
- Synonyms:
- Fluorescein di-(beta-D-glucopyranoside)
- 3',6'-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy]spiro[isobenzofuran-3,9'-xanthene]-1-one

Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-bis(β-D-glucopyranosyloxy)-
Ref: IN-DA000TO2
Undefined size | To inquire |

Ref: 54-BICS0116
1mg | 384.00 € | ||
2mg | 645.00 € | ||
5mg | 1,128.00 € |

Fluorescein di-β-D-glucopyranoside
Ref: 3D-EF04417
1mg | 223.00 € | ||
2mg | 318.00 € | ||
5mg | 464.00 € | ||
10mg | 822.00 € | ||
25mg | 1,784.00 € |