CAS 129790-08-5
:7-Bromo-1,2,3,4-tetrahydro-1,4,4-trimethylquinoline
Description:
7-Bromo-1,2,3,4-tetrahydro-1,4,4-trimethylquinoline is a chemical compound characterized by its unique bicyclic structure, which includes a quinoline moiety. This compound features a bromine atom at the 7-position and multiple methyl groups, contributing to its overall hydrophobicity and potential biological activity. The tetrahydro configuration indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring system that can influence its reactivity and stability. The presence of the bromine substituent may enhance its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the trimethyl groups can affect steric hindrance and solubility in organic solvents. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. As with many organic compounds, its behavior in biological systems, including potential toxicity and efficacy, would require further investigation through experimental studies.
Formula:C12H16BrN
InChI:InChI=1S/C12H16BrN/c1-12(2)6-7-14(3)11-8-9(13)4-5-10(11)12/h4-5,8H,6-7H2,1-3H3
InChI key:InChIKey=RLEQNPQAMRXNPT-UHFFFAOYSA-N
SMILES:CC1(C)C=2C(N(C)CC1)=CC(Br)=CC2
Synonyms:- Quinoline, 7-bromo-1,2,3,4-tetrahydro-1,4,4-trimethyl-
- 7-Bromo-1,2,3,4-tetrahydro-1,4,4-trimethylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
