CAS 1298031-95-4

8-Bromo-6-chloro-2-cyclopropylimidazo[1,2-b]pyridazine

Description:

8-Bromo-6-chloro-2-cyclopropylimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its complex structure, which includes both bromine and chlorine substituents on the imidazo-pyridazine framework. This compound features a cyclopropyl group, contributing to its unique reactivity and potential biological activity. The presence of halogens, such as bromine and chlorine, often enhances the lipophilicity and can influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. Its imidazo[1,2-b]pyridazine core is known for its potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. The compound's specific properties, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Overall, 8-Bromo-6-chloro-2-cyclopropylimidazo[1,2-b]pyridazine represents a significant structure in the realm of organic synthesis and drug discovery, warranting further investigation into its potential applications and mechanisms of action.

Formula: C₉H₇BrClN₃

InChI: InChI=1S/C9H7BrClN3/c10-6-3-8(11)13-14-4-7(5-1-2-5)12-9(6)14/h3-5H,1-2H2

InChI key: InChIKey=OYSHEISHKRCNMU-UHFFFAOYSA-N

SMILES: BrC=1C=2N(C=C(N2)C3CC3)N=C(Cl)C1

Synonyms:

• Imidazo[1,2-b]pyridazine, 8-bromo-6-chloro-2-cyclopropyl-
• 8-Bromo-6-chloro-2-cyclopropylimidazo[1,2-b]pyridazine

8-bromo-6-chloro-2-cyclopropylimidazo[1,2-b]pyridazine

CAS: 1298031-95-4

Formula: C₉H₇BrClN₃

Purity: 97%

Molecular weight: 272.5290

Ref: IN-DA01JU4K

8-Bromo-6-chloro-2-cyclopropylimidazo[1,2-b]pyridazine

CAS: 1298031-95-4

Purity: 97%

Molecular weight: 272.5299987792969

Ref: 10-F624654