CymitQuimica logo

CAS 1298034-45-3

:

5-(Cyclopropylmethyl)-4,5-dihydrospiro[1,5-benzoxazepine-2(3H),4′-piperidine]

Description:
5-(Cyclopropylmethyl)-4,5-dihydrospiro[1,5-benzoxazepine-2(3H),4′-piperidine] is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of benzoxazepine and piperidine. This compound features a cyclopropylmethyl group, contributing to its three-dimensional conformation and potentially influencing its biological activity. The presence of both a benzoxazepine and a piperidine moiety suggests that it may exhibit interesting pharmacological properties, possibly interacting with various biological targets. The dihydro configuration indicates that the compound may exist in a partially saturated form, which can affect its reactivity and stability. Additionally, the specific arrangement of functional groups within the molecule can lead to diverse chemical behaviors, making it a subject of interest in medicinal chemistry and drug development. As with many organic compounds, its solubility, melting point, and reactivity would depend on the surrounding conditions and the presence of other chemical entities. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C17H24N2O
InChI:InChI=1S/C17H24N2O/c1-2-4-16-15(3-1)19(13-14-5-6-14)12-9-17(20-16)7-10-18-11-8-17/h1-4,14,18H,5-13H2
InChI key:InChIKey=PFDMPQJDTSVLKE-UHFFFAOYSA-N
SMILES:C(N1CCC2(OC=3C1=CC=CC3)CCNCC2)C4CC4
Synonyms:
  • 5-(Cyclopropylmethyl)-4,5-dihydrospiro[1,5-benzoxazepine-2(3H),4′-piperidine]
  • Spiro[1,5-benzoxazepine-2(3H),4′-piperidine], 5-(cyclopropylmethyl)-4,5-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.