
CAS 1298044-25-3
:(2R)-2-(6-Bromo-2-methoxy-3-quinolinyl)-1-(1-naphthalenyl)-2-phenylethanone
Description:
The chemical substance known as (2R)-2-(6-Bromo-2-methoxy-3-quinolinyl)-1-(1-naphthalenyl)-2-phenylethanone, with the CAS number 1298044-25-3, is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a quinoline moiety, which is known for its aromatic properties and potential biological activity. The presence of a bromo substituent and a methoxy group on the quinoline ring suggests that this compound may exhibit unique reactivity and solubility characteristics. Additionally, the naphthalene and phenyl groups contribute to its overall hydrophobicity and may influence its interactions in biological systems. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, given the structural motifs that are often associated with pharmacological activity. Its stereochemistry, indicated by the (2R) designation, suggests specific spatial arrangements that could affect its biological interactions and efficacy. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C28H20BrNO2
InChI:InChI=1S/C28H20BrNO2/c1-32-28-24(17-20-16-21(29)14-15-25(20)30-28)26(19-9-3-2-4-10-19)27(31)23-13-7-11-18-8-5-6-12-22(18)23/h2-17,26H,1H3/t26-/m1/s1
InChI key:InChIKey=CNSCLWBBEGSWIM-AREMUKBSSA-N
SMILES:[C@H](C(=O)C=1C2=C(C=CC1)C=CC=C2)(C=3C(OC)=NC4=C(C3)C=C(Br)C=C4)C5=CC=CC=C5
Synonyms:- (2R)-2-(6-Bromo-2-methoxy-3-quinolinyl)-1-(1-naphthalenyl)-2-phenylethanone
- Ethanone, 2-(6-bromo-2-methoxy-3-quinolinyl)-1-(1-naphthalenyl)-2-phenyl-, (2R)-
- (2R)-2-(6-Bromo-2-methoxyquinolin-3-yl)-1-naphthalen-1-yl-2-phenylethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.