CAS 1298086-15-3

4-Bromo-1-chloro-2-[(4-ethoxyphenyl)(phenylmethoxy)methyl]benzene

Description:

4-Bromo-1-chloro-2-[(4-ethoxyphenyl)(phenylmethoxy)methyl]benzene is an organic compound characterized by its complex structure, which includes multiple aromatic rings and substituents. The presence of bromine and chlorine atoms indicates that it is a halogenated compound, which can influence its reactivity and physical properties, such as solubility and boiling point. The ethoxy and phenylmethoxy groups contribute to its overall hydrophobic character, potentially affecting its interactions in biological systems or chemical reactions. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, including halogenation and ether formation. Additionally, the compound's stability, reactivity, and potential applications would be influenced by the electronic effects of the substituents and the steric hindrance present in its molecular structure. Overall, this compound represents a unique example of a multifunctional aromatic system with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₂₂H₂₀BrClO₂

InChI: InChI=1S/C22H20BrClO2/c1-2-25-19-11-8-17(9-12-19)22(20-14-18(23)10-13-21(20)24)26-15-16-6-4-3-5-7-16/h3-14,22H,2,15H2,1H3

InChI key: InChIKey=BCXSFFOHQBIFOM-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(C2=C(Cl)C=CC(Br)=C2)C3=CC=C(OCC)C=C3

Synonyms:

• Benzene, 4-bromo-1-chloro-2-[(4-ethoxyphenyl)(phenylmethoxy)methyl]-
• 2-((Benzyloxy)(4-ethoxyphenyl)methyl)-4-bromo-1-chlorobenzene
• 4-Bromo-1-chloro-2-[(4-ethoxyphenyl)(phenylmethoxy)methyl]benzene

4-Bromo-1-chloro-2-[(4-ethoxyphenyl)(phenylmethoxy)methyl]benzene

CAS: 1298086-15-3

Formula: C₂₂H₂₀BrClO₂

Purity: 98%

Molecular weight: 431.7500

Ref: IN-DA000TOR