CymitQuimica logo

CAS 1298086-18-6

:

(1R,2S,3S,4R,5S)-1-(acetoxymethyl)-5-(4-chloro-3-(4-ethoxybenzyl)phenyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyltriacetate

Description:
The chemical substance with the name "(1R,2S,3S,4R,5S)-1-(acetoxymethyl)-5-(4-chloro-3-(4-ethoxybenzyl)phenyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyltriacetate" and CAS number "1298086-18-6" is a complex organic compound characterized by its bicyclic structure, which includes multiple functional groups such as acetoxy and chloro substituents. The presence of the dioxabicyclo framework indicates that it contains ether linkages, contributing to its stability and potential reactivity. The stereochemistry, denoted by the (1R,2S,3S,4R,5S) configuration, suggests specific spatial arrangements of atoms that can influence the compound's biological activity and interactions. The ethoxybenzyl group adds to its hydrophobic characteristics, potentially affecting solubility and permeability in biological systems. This compound may exhibit interesting pharmacological properties due to its structural complexity, making it a candidate for further research in medicinal chemistry. Its synthesis and applications would likely be of interest in the development of therapeutic agents or as a chemical probe in biological studies.
Formula:C30H33ClO11
InChI:InChI=1S/C30H33ClO11/c1-6-36-24-10-7-21(8-11-24)13-22-14-23(9-12-25(22)31)30-28(41-20(5)35)26(39-18(3)33)27(40-19(4)34)29(42-30,16-38-30)15-37-17(2)32/h7-12,14,26-28H,6,13,15-16H2,1-5H3/t26-,27-,28+,29-,30-/m0/s1
InChI key:LFZVLROKLDGLRV-KTBGKDHWSA-N
SMILES:CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@@]34[C@@H]([C@H]([C@@H]([C@@](O3)(CO4)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)Cl
Found 5 products.