CAS 129813-71-4
:Sulfonamides, C4-8-alkane, perfluoro, N-methyl-N-(2-oxiranylmethyl)
Description:
Sulfonamides, specifically the compound with the name "C4-8-alkane, perfluoro, N-methyl-N-(2-oxiranylmethyl)" and CAS number 129813-71-4, are a class of synthetic chemicals characterized by the presence of a sulfonamide functional group. This compound features a perfluorinated alkane chain, which contributes to its unique properties, such as increased hydrophobicity and chemical stability. The N-methyl-N-(2-oxiranylmethyl) moiety indicates the presence of an epoxide group, which can be reactive and may participate in various chemical reactions, including ring-opening reactions. The perfluorinated nature of the alkane chain often imparts properties such as low surface tension and resistance to degradation, making these compounds of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the structural characteristics suggest potential uses in materials science and as intermediates in organic synthesis. However, the specific biological activity, toxicity, and environmental impact of this compound would require further investigation to fully understand its implications in practical applications.
Formula:Unspecified
InChI:InChI=1/C7H8F7NO3S/c1-15(2-4-3-18-4)19(16,17)7(13,14)5(8,9)6(10,11)12/h4H,2-3H2,1H3
SMILES:CN(CC1CO1)S(=O)(=O)C(C(C(F)(F)F)(F)F)(F)F
Synonyms:- Sulfonamides, C4-8-alkane, perfluoro, N-methyl-N-(2-oxiranylmethyl)
- Sulfonamides, C4-8-alkane, perfluoro, N-methyl-N-(oxiranylmethyl)
- Sulfonamides, C<sub>4-8</sub>-alkane, perfluoro, N-methyl-N-(2-oxiranylmethyl)
- Sulfonamides, C<sub>4-8</sub>-alkane, perfluoro, N-methyl-N-(oxiranylmethyl)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Sulfonamides, C4-8-alkane, perfluoro, N-methyl-N-(2-oxiranylmethyl)
CAS:Formula:C7H8F7NO3SMolecular weight:319.1971

